Выполнить реакцию ОВР K₂Cr₂O₇+K I2+ H₂SO₄________K₂ SO₄+ I2 + Cr(SO₄)₃



Дополнение автора от 08.06.16 19:15:20

___K₂Cr₂O₇+KI+H₂SO₄            K₂ SO₄+I2+Cr(SO)

08.06.16
2 ответа

Лучший ответ по мнению автора

Cr2O7^(2-)+14H^(+)+6e = 2Cr^(3+)+7H2O   2 | 1
2I^(-)-2e = I2                                                 6 | 3
Cr2O7^(2-)+14H^(+)+6I^(-) = 2Cr^(3+)+7H2O+3I2
K2Cr2O7+7H2SO4+6KI = Cr2(SO4)3+7H2O+3I2+4K2SO4
08.06.16
Лучший ответ по мнению автора

Другие ответы

Уж если на то пошло, то не KI2, а K[I3]:

K2Cr2O7 + 6K[I3] + 7H2SO4 = 4K2SO4 + 9I2 + Cr2(SO4)3 + 7H2O.
08.06.16
Рекомендуем личную консультацию

Михаил Александров

Сейчас на сайте
Помогу подготовиться к работам и экзаменам (ЕГЭ, ГИА), сделать домашние задания, в том числе и вузовский курс (кроме теории вероятности и статистики), проконсультирую и настрою на систему обучения
Посмотреть всех экспертов из раздела Учеба и наука > Химия
1 ответ
27.01.11
Вопрос задан анонимно